Products 5349-99-5
CAS 5349-99-5 appears in our catalog under these names: Cilnidipine Impurity 5, Cilnidipine Impurity 1, Triethyl Aconitate, Triethyl aconitate, >95% (GC), Triethyl prop-1-ene-1,2,3-tricarboxylate, 95%, 95%. Offered by: Chemat Brand, Hubei YoungXin, TRC, Chemat, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg, 500mg.
Triethyl (Z)-prop-1-ene-1,2,3-tricarboxylate (CAS 5349-99-5) is a chemical compound with the molecular formula C12H18O6 and a molecular weight of 258.27 g/mol. IUPAC name: triethyl (Z)-prop-1-ene-1,2,3-tricarboxylate. InChIKey: IDDWGDKSBYYEPL-CLFYSBASSA-N.
| Molecular formula | C12H18O6 |
|---|---|
| Molecular weight | 258.27 g/mol |
| IUPAC name | triethyl (Z)-prop-1-ene-1,2,3-tricarboxylate |
| InChIKey | IDDWGDKSBYYEPL-CLFYSBASSA-N |
| SMILES | CCOC(=O)C/C(=C/C(=O)OCC)/C(=O)OCC |
Computed by PubChem (NCBI)
Synonyms:
TRIETHYL ACONITATE, 1-Propene-1,2,3-tricarboxylic acid, triethyl ester, ACONITIC ACID, TRIETHYL ESTER, cis-propene-1,2,3-tricarboxylic acid triethyl ester, (Z)-triethyl aconitate, TRIETHYL ACONITATE, (Z)-, (Z)-triethyl prop-1-ene-1,2,3-tricarboxylate, Triethyl (1z)-1-propene-1,2,3-tricarboxylate, 1,2,3-Propenetricarboxylic acid, triethyl ester