Products 2049-86-7

CAS 2049-86-7 is the registry number for 1,4-Diethyl 2,3-diacetylbutanedioate. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Diethyl 2,3-diacetylbutanedioate (CAS 2049-86-7) is a chemical compound with the molecular formula C12H18O6 and a molecular weight of 258.27 g/mol. IUPAC name: diethyl 2,3-diacetylbutanedioate. InChIKey: GJEDSIHWCPPJFN-UHFFFAOYSA-N.

Identity
Molecular formulaC12H18O6
Molecular weight258.27 g/mol
IUPAC namediethyl 2,3-diacetylbutanedioate
InChIKeyGJEDSIHWCPPJFN-UHFFFAOYSA-N
SMILESCCOC(=O)C(C(C(=O)C)C(=O)OCC)C(=O)C

Computed by PubChem (NCBI)