CAS 1680-21-3 appears in our catalog under these names: Triethylene glycol diacrylate, 95%, (Ethane–1,2–diylbis(oxy))bis(ethane–2,1–diyl) diacrylate, (Ethane-1,2-diylbis(oxy))bis(ethane-2,1-diyl) diacrylate 95% (stabilized with MEHQ), TRI(ETHYLENEGLYCOL) DIACRYLATE,CONTAINS&, Triethylene glycol diacrylate, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 1g, 250mg, 1000g, 100g, 500g, 25g, 1kg.
2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethyl prop-2-enoate (CAS 1680-21-3) is a chemical compound with the molecular formula C12H18O6 and a molecular weight of 258.27 g/mol. IUPAC name: 2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethyl prop-2-enoate. InChIKey: INQDDHNZXOAFFD-UHFFFAOYSA-N.
| Molecular formula | C12H18O6 |
|---|---|
| Molecular weight | 258.27 g/mol |
| IUPAC name | 2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethyl prop-2-enoate |
| InChIKey | INQDDHNZXOAFFD-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OCCOCCOCCOC(=O)C=C |
Computed by PubChem (NCBI)