CAS 13374-44-2 is the registry number for Isosorbide Diglycidyl Ether. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 1kg, 2kg, 5kg.
(3S,3aR,6R,6aR)-3,6-bis(oxiran-2-ylmethoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan (CAS 13374-44-2) is a chemical compound with the molecular formula C12H18O6 and a molecular weight of 258.27 g/mol. IUPAC name: (3S,3aR,6R,6aR)-3,6-bis(oxiran-2-ylmethoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan. InChIKey: JEBWAOITKHXCBF-BEAPMJEYSA-N.
| Molecular formula | C12H18O6 |
|---|---|
| Molecular weight | 258.27 g/mol |
| IUPAC name | (3S,3aR,6R,6aR)-3,6-bis(oxiran-2-ylmethoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
| InChIKey | JEBWAOITKHXCBF-BEAPMJEYSA-N |
| SMILES | C1[C@H]([C@@H]2[C@H](O1)[C@H](CO2)OCC3CO3)OCC4CO4 |
Computed by PubChem (NCBI)