cas: 457889-46-2 — see every product listed under this CAS number, including other names
(4'-(Trifluoromethyl)-[1,1'-biphenyl]-4-yl)methanol 97% (CAS 457889-46-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A121664-250mg |
| cas | 457889-46-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 192.38 Pln | |
| Ambeed | 5g | 476.06 Pln | |
| Ambeed | 10g | 871.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A121664 |
[4-[4-(trifluoromethyl)phenyl]phenyl]methanol (CAS 457889-46-2) is a chemical compound with the molecular formula C14H11F3O and a molecular weight of 252.23 g/mol. IUPAC name: [4-[4-(trifluoromethyl)phenyl]phenyl]methanol. InChIKey: YCVFDTRUBSFXSA-UHFFFAOYSA-N.
| Molecular formula | C14H11F3O |
|---|---|
| Molecular weight | 252.23 g/mol |
| IUPAC name | [4-[4-(trifluoromethyl)phenyl]phenyl]methanol |
| InChIKey | YCVFDTRUBSFXSA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CO)C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)