cas: 457889-46-2 — see every product listed under this CAS number, including other names
[4'-(Trifluoromethyl)[1,1'-biphenyl]-4-yl]methanol, 98% (CAS 457889-46-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F041778-250MG |
| cas | 457889-46-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 107.27 Pln | |
| Fluorochem | 1g | 200.99 Pln | |
| Fluorochem | 5g | 581.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
[4-[4-(trifluoromethyl)phenyl]phenyl]methanol (CAS 457889-46-2) is a chemical compound with the molecular formula C14H11F3O and a molecular weight of 252.23 g/mol. IUPAC name: [4-[4-(trifluoromethyl)phenyl]phenyl]methanol. InChIKey: YCVFDTRUBSFXSA-UHFFFAOYSA-N.
| Molecular formula | C14H11F3O |
|---|---|
| Molecular weight | 252.23 g/mol |
| IUPAC name | [4-[4-(trifluoromethyl)phenyl]phenyl]methanol |
| InChIKey | YCVFDTRUBSFXSA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CO)C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)