cas: 24006-92-6 — see every product listed under this CAS number, including other names
(4,5-Dichloro-1,2-phenylene)dimethanol, 96%, 96% (CAS 24006-92-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118OAL-100mg |
| cas | 24006-92-6 |
| size | 100mg |
| availability | 1.35g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 242.00 Pln | |
| Chemat | 250mg | 338.00 Pln | |
| Chemat | 1g | 755.60 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
[4,5-dichloro-2-(hydroxymethyl)phenyl]methanol (CAS 24006-92-6) is a chemical compound with the molecular formula C8H8Cl2O2 and a molecular weight of 207.05 g/mol. IUPAC name: [4,5-dichloro-2-(hydroxymethyl)phenyl]methanol. InChIKey: WSCRUXVCUXHCOW-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2O2 |
|---|---|
| Molecular weight | 207.05 g/mol |
| IUPAC name | [4,5-dichloro-2-(hydroxymethyl)phenyl]methanol |
| InChIKey | WSCRUXVCUXHCOW-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)Cl)CO)CO |
Computed by PubChem (NCBI)