CAS 1823363-25-2 is the registry number for (2,3-Dichloro-6-methoxyphenyl)methanol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
(2,3-dichloro-6-methoxyphenyl)methanol (CAS 1823363-25-2) is a chemical compound with the molecular formula C8H8Cl2O2 and a molecular weight of 207.05 g/mol. IUPAC name: (2,3-dichloro-6-methoxyphenyl)methanol. InChIKey: OMONSTSEXILJCC-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2O2 |
|---|---|
| Molecular weight | 207.05 g/mol |
| IUPAC name | (2,3-dichloro-6-methoxyphenyl)methanol |
| InChIKey | OMONSTSEXILJCC-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)Cl)Cl)CO |
Computed by PubChem (NCBI)