CAS 263704-31-0 is the registry number for 1-(2,3-Dichlorophenyl)ethane-1,2-diol, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
1-(2,3-dichlorophenyl)ethane-1,2-diol (CAS 263704-31-0) is a chemical compound with the molecular formula C8H8Cl2O2 and a molecular weight of 207.05 g/mol. IUPAC name: 1-(2,3-dichlorophenyl)ethane-1,2-diol. InChIKey: SIDJPCNXLFFGDH-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2O2 |
|---|---|
| Molecular weight | 207.05 g/mol |
| IUPAC name | 1-(2,3-dichlorophenyl)ethane-1,2-diol |
| InChIKey | SIDJPCNXLFFGDH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)C(CO)O |
Computed by PubChem (NCBI)