Products 89748-18-5

CAS 89748-18-5 is the registry number for 3,5-Dichloro-4-ethoxyphenol, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

3,5-dichloro-4-ethoxyphenol (CAS 89748-18-5) is a chemical compound with the molecular formula C8H8Cl2O2 and a molecular weight of 207.05 g/mol. IUPAC name: 3,5-dichloro-4-ethoxyphenol. InChIKey: DHVFDHKZVRGESE-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8Cl2O2
Molecular weight207.05 g/mol
IUPAC name3,5-dichloro-4-ethoxyphenol
InChIKeyDHVFDHKZVRGESE-UHFFFAOYSA-N
SMILESCCOC1=C(C=C(C=C1Cl)O)Cl

Computed by PubChem (NCBI)