CAS 90283-01-5 is the registry number for 1,5-dichloro-2,3-dimethoxybenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1,5-dichloro-2,3-dimethoxybenzene (CAS 90283-01-5) is a chemical compound with the molecular formula C8H8Cl2O2 and a molecular weight of 207.05 g/mol. IUPAC name: 1,5-dichloro-2,3-dimethoxybenzene. InChIKey: BCWABYVHGXOWHB-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2O2 |
|---|---|
| Molecular weight | 207.05 g/mol |
| IUPAC name | 1,5-dichloro-2,3-dimethoxybenzene |
| InChIKey | BCWABYVHGXOWHB-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)Cl)Cl)OC |
Computed by PubChem (NCBI)