cas: 1612184-33-4 — see every product listed under this CAS number, including other names
(4,5-Dichloro-2-methylphenyl)boronic acid 97% (CAS 1612184-33-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A105116-100mg |
| cas | 1612184-33-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 314.75 Pln | |
| Ambeed | 250mg | 370.38 Pln | |
| Ambeed | 1g | 648.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A105116 |
(4,5-dichloro-2-methylphenyl)boronic acid (CAS 1612184-33-4) is a chemical compound with the molecular formula C7H7BCl2O2 and a molecular weight of 204.85 g/mol. IUPAC name: (4,5-dichloro-2-methylphenyl)boronic acid. InChIKey: LBJTUVOHTOREJR-UHFFFAOYSA-N.
| Molecular formula | C7H7BCl2O2 |
|---|---|
| Molecular weight | 204.85 g/mol |
| IUPAC name | (4,5-dichloro-2-methylphenyl)boronic acid |
| InChIKey | LBJTUVOHTOREJR-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1C)Cl)Cl)(O)O |
Computed by PubChem (NCBI)