CAS 1612184-33-4 appears in our catalog under these names: 4,5-Dichloro-2-methylphenylboronic acid, 97%, 4,5-Dichloro-2-methylphenylboronic acid, 97%, 97%, (4,5-Dichloro-2-methylphenyl)boronic acid, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 250mg, 100mg.
(4,5-dichloro-2-methylphenyl)boronic acid (CAS 1612184-33-4) is a chemical compound with the molecular formula C7H7BCl2O2 and a molecular weight of 204.85 g/mol. IUPAC name: (4,5-dichloro-2-methylphenyl)boronic acid. InChIKey: LBJTUVOHTOREJR-UHFFFAOYSA-N.
| Molecular formula | C7H7BCl2O2 |
|---|---|
| Molecular weight | 204.85 g/mol |
| IUPAC name | (4,5-dichloro-2-methylphenyl)boronic acid |
| InChIKey | LBJTUVOHTOREJR-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1C)Cl)Cl)(O)O |
Computed by PubChem (NCBI)