CAS 851756-54-2 appears in our catalog under these names: 2,6-Dichloro-3-methylphenylboronic acid, 98%, 2,6–Dichloro–3–methylphenylboronic acid (contains varying amounts of Anhydride), 2,6-Dichloro-3-methylphenylboronic Acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 100g, 1g, 250mg, 10g.
(2,6-dichloro-3-methylphenyl)boronic acid (CAS 851756-54-2) is a chemical compound with the molecular formula C7H7BCl2O2 and a molecular weight of 204.85 g/mol. IUPAC name: (2,6-dichloro-3-methylphenyl)boronic acid. InChIKey: QRWVEDFFDGYSPO-UHFFFAOYSA-N.
| Molecular formula | C7H7BCl2O2 |
|---|---|
| Molecular weight | 204.85 g/mol |
| IUPAC name | (2,6-dichloro-3-methylphenyl)boronic acid |
| InChIKey | QRWVEDFFDGYSPO-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1Cl)C)Cl)(O)O |
Computed by PubChem (NCBI)