CAS 1072946-39-4 is the registry number for 2,6-Dichlorobenzylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
(2,6-dichlorophenyl)methylboronic acid (CAS 1072946-39-4) is a chemical compound with the molecular formula C7H7BCl2O2 and a molecular weight of 204.85 g/mol. IUPAC name: (2,6-dichlorophenyl)methylboronic acid. InChIKey: IVYUBQONLNWTIT-UHFFFAOYSA-N.
| Molecular formula | C7H7BCl2O2 |
|---|---|
| Molecular weight | 204.85 g/mol |
| IUPAC name | (2,6-dichlorophenyl)methylboronic acid |
| InChIKey | IVYUBQONLNWTIT-UHFFFAOYSA-N |
| SMILES | B(CC1=C(C=CC=C1Cl)Cl)(O)O |
Computed by PubChem (NCBI)