Products 1772622-45-3

CAS 1772622-45-3 appears in our catalog under these names: 3,4-Dichloro-5-methylphenylboronic acid, 95%, (3,4-Dichloro-5-methylphenyl)boronic acid, 97%, 3,4-Dichloro-5-methylphenylboronic acid, ≥95%, ≥95%, 3,4-Dichloro-5-methylphenylboronic acid, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.

Structural formula: {0} (CAS {1})

(3,4-dichloro-5-methylphenyl)boronic acid (CAS 1772622-45-3) is a chemical compound with the molecular formula C7H7BCl2O2 and a molecular weight of 204.85 g/mol. IUPAC name: (3,4-dichloro-5-methylphenyl)boronic acid. InChIKey: BGCJOTQVISYGAZ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7BCl2O2
Molecular weight204.85 g/mol
IUPAC name(3,4-dichloro-5-methylphenyl)boronic acid
InChIKeyBGCJOTQVISYGAZ-UHFFFAOYSA-N
SMILESB(C1=CC(=C(C(=C1)Cl)Cl)C)(O)O

Computed by PubChem (NCBI)