cas: 1016-58-6 — see every product listed under this CAS number, including other names
(4,5-Dimethoxy-2-nitrophenyl)methanol 98% (CAS 1016-58-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A159638-1g |
| cas | 1016-58-6 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 197.94 Pln | |
| Ambeed | 10g | 220.19 Pln | |
| Ambeed | 25g | 264.69 Pln | |
| Ambeed | 100g | 837.62 Pln | |
| Ambeed | 500g | 3913.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A159638 |
(4,5-dimethoxy-2-nitrophenyl)methanol (CAS 1016-58-6) is a chemical compound with the molecular formula C9H11NO5 and a molecular weight of 213.19 g/mol. IUPAC name: (4,5-dimethoxy-2-nitrophenyl)methanol. InChIKey: WBSCOJBVYHQOFB-UHFFFAOYSA-N.
| Molecular formula | C9H11NO5 |
|---|---|
| Molecular weight | 213.19 g/mol |
| IUPAC name | (4,5-dimethoxy-2-nitrophenyl)methanol |
| InChIKey | WBSCOJBVYHQOFB-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)CO)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)