CAS 1364917-20-3 is the registry number for 2,5,6-Trimethoxynicotinic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2,5,6-trimethoxypyridine-3-carboxylic acid (CAS 1364917-20-3) is a chemical compound with the molecular formula C9H11NO5 and a molecular weight of 213.19 g/mol. IUPAC name: 2,5,6-trimethoxypyridine-3-carboxylic acid. InChIKey: XXIDKZJJOQSGKI-UHFFFAOYSA-N.
| Molecular formula | C9H11NO5 |
|---|---|
| Molecular weight | 213.19 g/mol |
| IUPAC name | 2,5,6-trimethoxypyridine-3-carboxylic acid |
| InChIKey | XXIDKZJJOQSGKI-UHFFFAOYSA-N |
| SMILES | COC1=C(N=C(C(=C1)C(=O)O)OC)OC |
Computed by PubChem (NCBI)