CAS 102871-28-3 is the registry number for 1,2,4-trimethoxy-3-nitrobenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1,2,4-trimethoxy-3-nitrobenzene (CAS 102871-28-3) is a chemical compound with the molecular formula C9H11NO5 and a molecular weight of 213.19 g/mol. IUPAC name: 1,2,4-trimethoxy-3-nitrobenzene. InChIKey: VTQJJNUGVFKMSU-UHFFFAOYSA-N.
| Molecular formula | C9H11NO5 |
|---|---|
| Molecular weight | 213.19 g/mol |
| IUPAC name | 1,2,4-trimethoxy-3-nitrobenzene |
| InChIKey | VTQJJNUGVFKMSU-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)OC)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)