Products 156459-20-0

CAS 156459-20-0 is the registry number for 6-(Dimethoxymethyl)-2-hydroxynicotinic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg.

Structural formula: {0} (CAS {1})

6-(dimethoxymethyl)-2-oxo-1H-pyridine-3-carboxylic acid (CAS 156459-20-0) is a chemical compound with the molecular formula C9H11NO5 and a molecular weight of 213.19 g/mol. IUPAC name: 6-(dimethoxymethyl)-2-oxo-1H-pyridine-3-carboxylic acid. InChIKey: CZJSQHBIIDJZBA-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11NO5
Molecular weight213.19 g/mol
IUPAC name6-(dimethoxymethyl)-2-oxo-1H-pyridine-3-carboxylic acid
InChIKeyCZJSQHBIIDJZBA-UHFFFAOYSA-N
SMILESCOC(C1=CC=C(C(=O)N1)C(=O)O)OC

Computed by PubChem (NCBI)