CAS 34211-48-8 appears in our catalog under these names: 3-(4-Nitrophenoxy)propane-1,2-diol, 95%, 3-(4-Nitrophenoxy)propane-1,2-diol, 3-(4-Nitrophenoxy)propane-1,2-diol, 95%, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 250mg, 1g, 25mg, 0,5g, 50mg, 100mg.
3-(4-nitrophenoxy)propane-1,2-diol (CAS 34211-48-8) is a chemical compound with the molecular formula C9H11NO5 and a molecular weight of 213.19 g/mol. IUPAC name: 3-(4-nitrophenoxy)propane-1,2-diol. InChIKey: YERGZLQRVWFVAZ-UHFFFAOYSA-N.
| Molecular formula | C9H11NO5 |
|---|---|
| Molecular weight | 213.19 g/mol |
| IUPAC name | 3-(4-nitrophenoxy)propane-1,2-diol |
| InChIKey | YERGZLQRVWFVAZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])OCC(CO)O |
Computed by PubChem (NCBI)