cas: 279262-15-6 — see every product listed under this CAS number, including other names
(4–(2–Ethoxyethoxy)phenyl)boronic acid (CAS 279262-15-6) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GF52066-10g |
| cas | 279262-15-6 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10g | 3611.28 Pln | |
| GLPBio | 1g | 915.31 Pln | |
| GLPBio | 250mg | 601.72 Pln | |
| GLPBio | 5g | 2413.07 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
[4-(2-ethoxyethoxy)phenyl]boronic acid (CAS 279262-15-6) is a chemical compound with the molecular formula C10H15BO4 and a molecular weight of 210.04 g/mol. IUPAC name: [4-(2-ethoxyethoxy)phenyl]boronic acid. InChIKey: CPKQGDUGMWMRNE-UHFFFAOYSA-N.
| Molecular formula | C10H15BO4 |
|---|---|
| Molecular weight | 210.04 g/mol |
| IUPAC name | [4-(2-ethoxyethoxy)phenyl]boronic acid |
| InChIKey | CPKQGDUGMWMRNE-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)OCCOCC)(O)O |
Computed by PubChem (NCBI)