cas: 913835-38-8 — see every product listed under this CAS number, including other names
(4-((2,4-Dimethylphenyl)carbamoyl)phenyl)boronic acid, 95%, 95% (CAS 913835-38-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117BHU-1g |
| cas | 913835-38-8 |
| size | 1g |
| availability | 9.6g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 232.40 Pln | |
| Chemat | 5g | 477.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
[4-[(2,4-dimethylphenyl)carbamoyl]phenyl]boronic acid (CAS 913835-38-8) is a chemical compound with the molecular formula C15H16BNO3 and a molecular weight of 269.11 g/mol. IUPAC name: [4-[(2,4-dimethylphenyl)carbamoyl]phenyl]boronic acid. InChIKey: IOBVTQYGKMKSSL-UHFFFAOYSA-N.
| Molecular formula | C15H16BNO3 |
|---|---|
| Molecular weight | 269.11 g/mol |
| IUPAC name | [4-[(2,4-dimethylphenyl)carbamoyl]phenyl]boronic acid |
| InChIKey | IOBVTQYGKMKSSL-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)NC2=C(C=C(C=C2)C)C)(O)O |
Computed by PubChem (NCBI)