cas: 2096341-77-2 — see every product listed under this CAS number, including other names
(4-((tert-Butyldimethylsilyl)oxy)-2,6-difluorophenyl)boronic acid 98% (CAS 2096341-77-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A395266-100mg |
| cas | 2096341-77-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 242.44 Pln | |
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 592.88 Pln | |
| Ambeed | 5g | 1638.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A395266 |
[4-[tert-butyl(dimethyl)silyl]oxy-2,6-difluorophenyl]boronic acid (CAS 2096341-77-2) is a chemical compound with the molecular formula C12H19BF2O3Si and a molecular weight of 288.17 g/mol. IUPAC name: [4-[tert-butyl(dimethyl)silyl]oxy-2,6-difluorophenyl]boronic acid. InChIKey: SAXLUFSXLIRBKM-UHFFFAOYSA-N.
| Molecular formula | C12H19BF2O3Si |
|---|---|
| Molecular weight | 288.17 g/mol |
| IUPAC name | [4-[tert-butyl(dimethyl)silyl]oxy-2,6-difluorophenyl]boronic acid |
| InChIKey | SAXLUFSXLIRBKM-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1F)O[Si](C)(C)C(C)(C)C)F)(O)O |
Computed by PubChem (NCBI)