cas: 2096341-77-2 — see every product listed under this CAS number, including other names
4-(t-Butyldimethylsilyloxy)-2,6-difluorophenylboronic acid, 98%, 98% (CAS 2096341-77-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12EHFT-100mg |
| cas | 2096341-77-2 |
| size | 100mg |
| availability | 6g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 198.80 Pln | |
| Chemat | 250mg | 290.00 Pln | |
| Chemat | 1g | 630.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[4-[tert-butyl(dimethyl)silyl]oxy-2,6-difluorophenyl]boronic acid (CAS 2096341-77-2) is a chemical compound with the molecular formula C12H19BF2O3Si and a molecular weight of 288.17 g/mol. IUPAC name: [4-[tert-butyl(dimethyl)silyl]oxy-2,6-difluorophenyl]boronic acid. InChIKey: SAXLUFSXLIRBKM-UHFFFAOYSA-N.
| Molecular formula | C12H19BF2O3Si |
|---|---|
| Molecular weight | 288.17 g/mol |
| IUPAC name | [4-[tert-butyl(dimethyl)silyl]oxy-2,6-difluorophenyl]boronic acid |
| InChIKey | SAXLUFSXLIRBKM-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1F)O[Si](C)(C)C(C)(C)C)F)(O)O |
Computed by PubChem (NCBI)