cas: 1025495-85-5 — see every product listed under this CAS number, including other names
(4-(3,5-Dimethyl-1H-pyrazol-1-yl)phenyl)boronic acid, 96% (CAS 1025495-85-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F210959-250MG |
| cas | 1025495-85-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 476.93 Pln | |
| Fluorochem | 1g | 1153.78 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
[4-(3,5-dimethylpyrazol-1-yl)phenyl]boronic acid (CAS 1025495-85-5) is a chemical compound with the molecular formula C11H13BN2O2 and a molecular weight of 216.05 g/mol. IUPAC name: [4-(3,5-dimethylpyrazol-1-yl)phenyl]boronic acid. InChIKey: OJUOPNGDUVRDFU-UHFFFAOYSA-N.
| Molecular formula | C11H13BN2O2 |
|---|---|
| Molecular weight | 216.05 g/mol |
| IUPAC name | [4-(3,5-dimethylpyrazol-1-yl)phenyl]boronic acid |
| InChIKey | OJUOPNGDUVRDFU-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)N2C(=CC(=N2)C)C)(O)O |
Computed by PubChem (NCBI)