CAS 1025735-46-9 appears in our catalog under these names: (3–(3,5–Dimethyl–1H–pyrazol–1–yl)phenyl)boronic acid, 3-(3,5-Dimethyl-1H-pyrazol-1-yl)phenylboronic acid, 98%, 98%, [3-(3,5-dimethyl-1H-pyrazol-1-yl)phenyl]boronic acid, 98%, 3-(3,5-Dimethyl-1H-pyrazol-1-yl)phenylboronic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg, 5g, 25g.
[3-(3,5-dimethylpyrazol-1-yl)phenyl]boronic acid (CAS 1025735-46-9) is a chemical compound with the molecular formula C11H13BN2O2 and a molecular weight of 216.05 g/mol. IUPAC name: [3-(3,5-dimethylpyrazol-1-yl)phenyl]boronic acid. InChIKey: RBSKBRQNRWKHSP-UHFFFAOYSA-N.
| Molecular formula | C11H13BN2O2 |
|---|---|
| Molecular weight | 216.05 g/mol |
| IUPAC name | [3-(3,5-dimethylpyrazol-1-yl)phenyl]boronic acid |
| InChIKey | RBSKBRQNRWKHSP-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)N2C(=CC(=N2)C)C)(O)O |
Computed by PubChem (NCBI)