(4-(Aminomethyl)phenyl)(imino)(methyl)-l6-sulfanone hydrochloride, 95%
cas: 1817776-45-6 — see every product listed under this CAS number, including other names
(4-(Aminomethyl)phenyl)(imino)(methyl)-l6-sulfanone hydrochloride, 95% (CAS 1817776-45-6) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A2442300-10mg |
| cas | 1817776-45-6 |
| size | 10mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10mg | 570.62 Pln | |
| Ambeed | 25mg | 1021.19 Pln | |
| Ambeed | 50mg | 1683.12 Pln | |
| Ambeed | 100mg | 2406.25 Pln | |
| BLDpharm | 10mg | 614.25 Pln | |
| BLDpharm | 25mg | 1097.42 Pln | |
| BLDpharm | 50mg | 1808.28 Pln | |
| BLDpharm | 100mg | 2591.33 Pln | |
| BLDpharm | 250mg | 4290.74 Pln | |
| BLDpharm | 1g | 14420.50 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
[4-(methylsulfonimidoyl)phenyl]methanamine;hydrochloride (CAS 1817776-45-6) is a chemical compound with the molecular formula C8H13ClN2OS and a molecular weight of 220.72 g/mol. IUPAC name: [4-(methylsulfonimidoyl)phenyl]methanamine;hydrochloride. InChIKey: IKPZUTKFFSSARH-UHFFFAOYSA-N.
| Molecular formula | C8H13ClN2OS |
|---|---|
| Molecular weight | 220.72 g/mol |
| IUPAC name | [4-(methylsulfonimidoyl)phenyl]methanamine;hydrochloride |
| InChIKey | IKPZUTKFFSSARH-UHFFFAOYSA-N |
| SMILES | CS(=N)(=O)C1=CC=C(C=C1)CN.Cl |
Computed by PubChem (NCBI)