CAS 2155852-23-4 is the registry number for 5-((Oxolan-2-yl)methyl)-1,3-thiazol-2-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-(oxolan-2-ylmethyl)-1,3-thiazol-2-amine;hydrochloride (CAS 2155852-23-4) is a chemical compound with the molecular formula C8H13ClN2OS and a molecular weight of 220.72 g/mol. IUPAC name: 5-(oxolan-2-ylmethyl)-1,3-thiazol-2-amine;hydrochloride. InChIKey: ZOHGQTPCVXXPCF-UHFFFAOYSA-N.
| Molecular formula | C8H13ClN2OS |
|---|---|
| Molecular weight | 220.72 g/mol |
| IUPAC name | 5-(oxolan-2-ylmethyl)-1,3-thiazol-2-amine;hydrochloride |
| InChIKey | ZOHGQTPCVXXPCF-UHFFFAOYSA-N |
| SMILES | C1CC(OC1)CC2=CN=C(S2)N.Cl |
Computed by PubChem (NCBI)