Products 1817776-45-6
CAS 1817776-45-6 is the registry number for (4-(Aminomethyl)phenyl)(imino)(methyl)-l6-sulfanone hydrochloride, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 25mg, 50mg, 10mg.
[4-(methylsulfonimidoyl)phenyl]methanamine;hydrochloride (CAS 1817776-45-6) is a chemical compound with the molecular formula C8H13ClN2OS and a molecular weight of 220.72 g/mol. IUPAC name: [4-(methylsulfonimidoyl)phenyl]methanamine;hydrochloride. InChIKey: IKPZUTKFFSSARH-UHFFFAOYSA-N.
| Molecular formula | C8H13ClN2OS |
|---|---|
| Molecular weight | 220.72 g/mol |
| IUPAC name | [4-(methylsulfonimidoyl)phenyl]methanamine;hydrochloride |
| InChIKey | IKPZUTKFFSSARH-UHFFFAOYSA-N |
| SMILES | CS(=N)(=O)C1=CC=C(C=C1)CN.Cl |
Computed by PubChem (NCBI)