CAS 2326563-31-7 is the registry number for 3-(AMinomethyl)-6-methyl-4-(methylthio)pyridin-2(1H)-one xhydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(aminomethyl)-6-methyl-4-methylsulfanyl-1H-pyridin-2-one;hydrochloride (CAS 2326563-31-7) is a chemical compound with the molecular formula C8H13ClN2OS and a molecular weight of 220.72 g/mol. IUPAC name: 3-(aminomethyl)-6-methyl-4-methylsulfanyl-1H-pyridin-2-one;hydrochloride. InChIKey: ONDHYDSSWVNVEW-UHFFFAOYSA-N.
| Molecular formula | C8H13ClN2OS |
|---|---|
| Molecular weight | 220.72 g/mol |
| IUPAC name | 3-(aminomethyl)-6-methyl-4-methylsulfanyl-1H-pyridin-2-one;hydrochloride |
| InChIKey | ONDHYDSSWVNVEW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=O)N1)CN)SC.Cl |
Computed by PubChem (NCBI)