CAS 2326565-23-3 appears in our catalog under these names: 3-(Aminomethyl)-6-methyl-4-(methylthio)pyridin-2(1H)-one hydrochloride, 98%, 3-(Aminomethyl)-6-methyl-4-(methylthio)pyridin-2(1H)-one Hydrochloride, ≥95%, ≥95%. Offered by: AmBeed, Chemat. Available pack sizes: 25g, 100mg, 250mg, 1g, 5g, 10g.
3-(aminomethyl)-6-methyl-4-methylsulfanyl-1H-pyridin-2-one;hydrochloride (CAS 2326565-23-3) is a chemical compound with the molecular formula C8H13ClN2OS and a molecular weight of 220.72 g/mol. IUPAC name: 3-(aminomethyl)-6-methyl-4-methylsulfanyl-1H-pyridin-2-one;hydrochloride. InChIKey: ONDHYDSSWVNVEW-UHFFFAOYSA-N.
| Molecular formula | C8H13ClN2OS |
|---|---|
| Molecular weight | 220.72 g/mol |
| IUPAC name | 3-(aminomethyl)-6-methyl-4-methylsulfanyl-1H-pyridin-2-one;hydrochloride |
| InChIKey | ONDHYDSSWVNVEW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=O)N1)CN)SC.Cl |
Computed by PubChem (NCBI)