cas: 915401-97-7 — see every product listed under this CAS number, including other names
(4-(Difluoromethoxy)-3,5-difluorophenyl)boronic acid 98% (CAS 915401-97-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A163902-250mg |
| cas | 915401-97-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 437.12 Pln | |
| Ambeed | 1g | 909.94 Pln | |
| Ambeed | 5g | 2584.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A163902 |
[4-(difluoromethoxy)-3,5-difluorophenyl]boronic acid (CAS 915401-97-7) is a chemical compound with the molecular formula C7H5BF4O3 and a molecular weight of 223.92 g/mol. IUPAC name: [4-(difluoromethoxy)-3,5-difluorophenyl]boronic acid. InChIKey: MMZMGLLJCWTMAV-UHFFFAOYSA-N.
| Molecular formula | C7H5BF4O3 |
|---|---|
| Molecular weight | 223.92 g/mol |
| IUPAC name | [4-(difluoromethoxy)-3,5-difluorophenyl]boronic acid |
| InChIKey | MMZMGLLJCWTMAV-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)F)OC(F)F)F)(O)O |
Computed by PubChem (NCBI)