cas: 850568-17-1 — see every product listed under this CAS number, including other names
(4-(Methoxycarbamoyl)phenyl)boronic acid 95% (CAS 850568-17-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A919220-250mg |
| cas | 850568-17-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 181.25 Pln | |
| Ambeed | 1g | 331.44 Pln | |
| Ambeed | 5g | 909.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A919220 |
[4-(methoxycarbamoyl)phenyl]boronic acid (CAS 850568-17-1) is a chemical compound with the molecular formula C8H10BNO4 and a molecular weight of 194.98 g/mol. IUPAC name: [4-(methoxycarbamoyl)phenyl]boronic acid. InChIKey: MZZWCLBDQROHHS-UHFFFAOYSA-N.
| Molecular formula | C8H10BNO4 |
|---|---|
| Molecular weight | 194.98 g/mol |
| IUPAC name | [4-(methoxycarbamoyl)phenyl]boronic acid |
| InChIKey | MZZWCLBDQROHHS-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)NOC)(O)O |
Computed by PubChem (NCBI)