CAS 2225170-39-6 appears in our catalog under these names: 2-(Methoxycarbonyl)-6-methylpyridine-4-boronic acid, 98%, (2–(METHOXYCARBONYL)–6–METHYLPYRIDIN–4–YL)BORONIC ACID. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg, 25mg, 5mg.
(2-methoxycarbonyl-6-methyl-4-pyridinyl)boronic acid (CAS 2225170-39-6) is a chemical compound with the molecular formula C8H10BNO4 and a molecular weight of 194.98 g/mol. IUPAC name: (2-methoxycarbonyl-6-methyl-4-pyridinyl)boronic acid. InChIKey: XSFSORCGLDELRQ-UHFFFAOYSA-N.
| Molecular formula | C8H10BNO4 |
|---|---|
| Molecular weight | 194.98 g/mol |
| IUPAC name | (2-methoxycarbonyl-6-methyl-4-pyridinyl)boronic acid |
| InChIKey | XSFSORCGLDELRQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=NC(=C1)C(=O)OC)C)(O)O |
Computed by PubChem (NCBI)