CAS 1127647-65-7 is the registry number for 5-(Aminocarbonyl)-2-methoxyphenylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 250mg, 1g.
(5-carbamoyl-2-methoxyphenyl)boronic acid (CAS 1127647-65-7) is a chemical compound with the molecular formula C8H10BNO4 and a molecular weight of 194.98 g/mol. IUPAC name: (5-carbamoyl-2-methoxyphenyl)boronic acid. InChIKey: NVZRRVKTPGPRHU-UHFFFAOYSA-N.
| Molecular formula | C8H10BNO4 |
|---|---|
| Molecular weight | 194.98 g/mol |
| IUPAC name | (5-carbamoyl-2-methoxyphenyl)boronic acid |
| InChIKey | NVZRRVKTPGPRHU-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C(=O)N)OC)(O)O |
Computed by PubChem (NCBI)