CAS 850568-17-1 appears in our catalog under these names: 4-(O-Methylhydroxylaminocarbonyl)phenylboronic acid, 98%, 4–(O–Methylhydroxylaminocarbonyl)phenylboronic acid, 4-(O-Methylhydroxylaminocarbonyl)phenylboronic acid, 95%, 95%, (4-(Methoxycarbamoyl)phenyl)boronic acid, 97%, (4-(Methoxycarbamoyl)phenyl)boronic acid, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 250mg.
[4-(methoxycarbamoyl)phenyl]boronic acid (CAS 850568-17-1) is a chemical compound with the molecular formula C8H10BNO4 and a molecular weight of 194.98 g/mol. IUPAC name: [4-(methoxycarbamoyl)phenyl]boronic acid. InChIKey: MZZWCLBDQROHHS-UHFFFAOYSA-N.
| Molecular formula | C8H10BNO4 |
|---|---|
| Molecular weight | 194.98 g/mol |
| IUPAC name | [4-(methoxycarbamoyl)phenyl]boronic acid |
| InChIKey | MZZWCLBDQROHHS-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)NOC)(O)O |
Computed by PubChem (NCBI)