CAS 1072952-38-5 appears in our catalog under these names: 2-(1,3-Dioxolan-2-yl)pyridine-5-boronic acid, 95%, (6-(1,3-Dioxolan-2-yl)pyridin-3-yl)boronic acid, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
[6-(1,3-dioxolan-2-yl)-3-pyridinyl]boronic acid (CAS 1072952-38-5) is a chemical compound with the molecular formula C8H10BNO4 and a molecular weight of 194.98 g/mol. IUPAC name: [6-(1,3-dioxolan-2-yl)-3-pyridinyl]boronic acid. InChIKey: CHBZOUJAMDSHIH-UHFFFAOYSA-N.
| Molecular formula | C8H10BNO4 |
|---|---|
| Molecular weight | 194.98 g/mol |
| IUPAC name | [6-(1,3-dioxolan-2-yl)-3-pyridinyl]boronic acid |
| InChIKey | CHBZOUJAMDSHIH-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(C=C1)C2OCCO2)(O)O |
Computed by PubChem (NCBI)