cas: 871329-65-6 — see every product listed under this CAS number, including other names
(4-(N-Ethylsulfamoyl)phenyl)boronic acid, 95% (CAS 871329-65-6) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F694269-1G |
| cas | 871329-65-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1559.89 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
[4-(ethylsulfamoyl)phenyl]boronic acid (CAS 871329-65-6) is a chemical compound with the molecular formula C8H12BNO4S and a molecular weight of 229.07 g/mol. IUPAC name: [4-(ethylsulfamoyl)phenyl]boronic acid. InChIKey: YVKVLCDUDPTJEW-UHFFFAOYSA-N.
| Molecular formula | C8H12BNO4S |
|---|---|
| Molecular weight | 229.07 g/mol |
| IUPAC name | [4-(ethylsulfamoyl)phenyl]boronic acid |
| InChIKey | YVKVLCDUDPTJEW-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)S(=O)(=O)NCC)(O)O |
Computed by PubChem (NCBI)