cas: 850568-25-1 — see every product listed under this CAS number, including other names
(4-(Pyridin-2-ylcarbamoyl)phenyl)boronic acid, 98% (CAS 850568-25-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F447768-100MG |
| cas | 850568-25-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 102.07 Pln | |
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 250mg | 107.27 Pln | |
| Fluorochem | 5g | 253.05 Pln | |
| Fluorochem | 10g | 450.90 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
[4-(pyridin-2-ylcarbamoyl)phenyl]boronic acid (CAS 850568-25-1) is a chemical compound with the molecular formula C12H11BN2O3 and a molecular weight of 242.04 g/mol. IUPAC name: [4-(pyridin-2-ylcarbamoyl)phenyl]boronic acid. InChIKey: LEAZDTWQWNXKJM-UHFFFAOYSA-N.
| Molecular formula | C12H11BN2O3 |
|---|---|
| Molecular weight | 242.04 g/mol |
| IUPAC name | [4-(pyridin-2-ylcarbamoyl)phenyl]boronic acid |
| InChIKey | LEAZDTWQWNXKJM-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)NC2=CC=CC=N2)(O)O |
Computed by PubChem (NCBI)