CAS 874459-98-0 appears in our catalog under these names: 3-(2-Pyridylcarbamoyl)benzeneboronic acid 95%, Boronic acid, [3-[(2-pyridinylamino)carbonyl]phenyl], 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
[3-(pyridin-2-ylcarbamoyl)phenyl]boronic acid (CAS 874459-98-0) is a chemical compound with the molecular formula C12H11BN2O3 and a molecular weight of 242.04 g/mol. IUPAC name: [3-(pyridin-2-ylcarbamoyl)phenyl]boronic acid. InChIKey: ZWLNCTKSPAGVIT-UHFFFAOYSA-N.
| Molecular formula | C12H11BN2O3 |
|---|---|
| Molecular weight | 242.04 g/mol |
| IUPAC name | [3-(pyridin-2-ylcarbamoyl)phenyl]boronic acid |
| InChIKey | ZWLNCTKSPAGVIT-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C(=O)NC2=CC=CC=N2)(O)O |
Computed by PubChem (NCBI)