Products 2246548-35-4
CAS 2246548-35-4 appears in our catalog under these names: 4–(nicotinamido)phenylboronic acid, 4-(Nicotinamido)phenylboronic acid, 95%, (4-(Nicotinamido)phenyl)boronic acid, 98%. Offered by: GLPBio, Combi-blocks, AmBeed. Available pack sizes: 100mg, 25mg, 1g, 250mg.
[4-(pyridine-3-carbonylamino)phenyl]boronic acid (CAS 2246548-35-4) is a chemical compound with the molecular formula C12H11BN2O3 and a molecular weight of 242.04 g/mol. IUPAC name: [4-(pyridine-3-carbonylamino)phenyl]boronic acid. InChIKey: PCGJUKGGDXXZBD-UHFFFAOYSA-N.
| Molecular formula | C12H11BN2O3 |
|---|---|
| Molecular weight | 242.04 g/mol |
| IUPAC name | [4-(pyridine-3-carbonylamino)phenyl]boronic acid |
| InChIKey | PCGJUKGGDXXZBD-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)NC(=O)C2=CN=CC=C2)(O)O |
Computed by PubChem (NCBI)