Products 2246591-15-9
CAS 2246591-15-9 appears in our catalog under these names: (4-(ISONICOTINAMIDO)PHENYL)BORONIC ACID, 98%, 98%, (4-(ISONICOTINAMIDO)PHENYL)BORONIC ACID, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
[4-(pyridine-4-carbonylamino)phenyl]boronic acid (CAS 2246591-15-9) is a chemical compound with the molecular formula C12H11BN2O3 and a molecular weight of 242.04 g/mol. IUPAC name: [4-(pyridine-4-carbonylamino)phenyl]boronic acid. InChIKey: QKCLYOYDHNAYDX-UHFFFAOYSA-N.
| Molecular formula | C12H11BN2O3 |
|---|---|
| Molecular weight | 242.04 g/mol |
| IUPAC name | [4-(pyridine-4-carbonylamino)phenyl]boronic acid |
| InChIKey | QKCLYOYDHNAYDX-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)NC(=O)C2=CC=NC=C2)(O)O |
Computed by PubChem (NCBI)