CAS 1821640-79-2 appears in our catalog under these names: (3-(Isonicotinamido)phenyl)boronic acid, 95%, (3-(Isonicotinamido)phenyl)boronic acid, 98%, (3–(pyridine–4–amido)phenyl)boronic acid, (3-(isonicotinamido)phenyl)boronic acid, 98%, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
[3-(pyridine-4-carbonylamino)phenyl]boronic acid (CAS 1821640-79-2) is a chemical compound with the molecular formula C12H11BN2O3 and a molecular weight of 242.04 g/mol. IUPAC name: [3-(pyridine-4-carbonylamino)phenyl]boronic acid. InChIKey: MBHNUTSMGOJZDJ-UHFFFAOYSA-N.
| Molecular formula | C12H11BN2O3 |
|---|---|
| Molecular weight | 242.04 g/mol |
| IUPAC name | [3-(pyridine-4-carbonylamino)phenyl]boronic acid |
| InChIKey | MBHNUTSMGOJZDJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)NC(=O)C2=CC=NC=C2)(O)O |
Computed by PubChem (NCBI)