cas: 626251-12-5 — see every product listed under this CAS number, including other names
(4-Acetamido-3-fluorophenyl)boronic acid, 95% (CAS 626251-12-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F691554-100MG |
| cas | 626251-12-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 799.74 Pln | |
| Fluorochem | 250mg | 1320.39 Pln | |
| Fluorochem | 1g | 3309.27 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(4-acetamido-3-fluorophenyl)boronic acid (CAS 626251-12-5) is a chemical compound with the molecular formula C8H9BFNO3 and a molecular weight of 196.97 g/mol. IUPAC name: (4-acetamido-3-fluorophenyl)boronic acid. InChIKey: RSBBBRALHOPKCM-UHFFFAOYSA-N.
| Molecular formula | C8H9BFNO3 |
|---|---|
| Molecular weight | 196.97 g/mol |
| IUPAC name | (4-acetamido-3-fluorophenyl)boronic acid |
| InChIKey | RSBBBRALHOPKCM-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)NC(=O)C)F)(O)O |
Computed by PubChem (NCBI)