cas: 31431-19-3 — see every product listed under this CAS number, including other names
(4-Amino-3-nitrophenyl)(phenyl)methanone (CAS 31431-19-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F324907-5G |
| cas | 31431-19-3 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 107.27 Pln | |
| Fluorochem | 10g | 133.30 Pln | |
| Fluorochem | 25g | 159.34 Pln | |
| Fluorochem | 100g | 331.15 Pln |
| delivery time | 3-4 weeks |
|---|
(4-amino-3-nitrophenyl)-phenylmethanone (CAS 31431-19-3) is a chemical compound with the molecular formula C13H10N2O3 and a molecular weight of 242.23 g/mol. IUPAC name: (4-amino-3-nitrophenyl)-phenylmethanone. InChIKey: NGOOFAMQPUEDJM-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O3 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | (4-amino-3-nitrophenyl)-phenylmethanone |
| InChIKey | NGOOFAMQPUEDJM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC(=C(C=C2)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)