cas: 31431-19-3 — see every product listed under this CAS number, including other names
4-Amino-3-nitrobenzophenone 97% (CAS 31431-19-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A211738-10g |
| cas | 31431-19-3 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 142.31 Pln | |
| Ambeed | 100g | 359.25 Pln | |
| Ambeed | 500g | 1093.50 Pln | |
| Ambeed | 1000g | 2061.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A211738 |
(4-amino-3-nitrophenyl)-phenylmethanone (CAS 31431-19-3) is a chemical compound with the molecular formula C13H10N2O3 and a molecular weight of 242.23 g/mol. IUPAC name: (4-amino-3-nitrophenyl)-phenylmethanone. InChIKey: NGOOFAMQPUEDJM-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O3 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | (4-amino-3-nitrophenyl)-phenylmethanone |
| InChIKey | NGOOFAMQPUEDJM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC(=C(C=C2)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)