(4-Boc-Aminophenyl),boronic acid, 98%, 98%
cas: 380430-49-9 — see every product listed under this CAS number, including other names
(4-Boc-Aminophenyl),boronic acid, 98%, 98% (CAS 380430-49-9) is a chemical reagent available from Chemat. Available pack sizes: 50g, 250g, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I8HH-50g |
| cas | 380430-49-9 |
| size | 50g |
| availability | 1000g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 50g | 338.00 Pln | |
| Chemat | 250g | 1302.80 Pln | |
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 93.20 Pln | |
| Chemat | 10g | 122.00 Pln | |
| Chemat | 25g | 203.60 Pln | |
| Chemat | 100g | 578.00 Pln | |
| Chemat | 500g | 2404.80 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid (CAS 380430-49-9) is a chemical compound with the molecular formula C11H16BNO4 and a molecular weight of 237.06 g/mol. IUPAC name: [4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid. InChIKey: UBVOLHQIEQVXGM-UHFFFAOYSA-N.
| Molecular formula | C11H16BNO4 |
|---|---|
| Molecular weight | 237.06 g/mol |
| IUPAC name | [4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid |
| InChIKey | UBVOLHQIEQVXGM-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)NC(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(4-Boc-Aminophenyl)Boronic Acid, 4-(N-Boc-amino)phenylboronic acid, 4-BOC-aminophenylboronic acid, (4-((tert-Butoxycarbonyl)amino)phenyl)boronic acid, [4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic Acid, 4-(Boc-amino)phenylboronic Acid, 4-(tert-Butoxycarbonyl)aminophenylboronic acid, (4-{[(tert-butoxy)carbonyl]amino}phenyl)boronic acid, (4-Boc-Aminophenyl);boronic acid, 4-[(tert-butoxycarbonyl)amino]phenylboronic acid