CAS 380430-49-9 appears in our catalog under these names: 4-Boc-aminophenylboronic acid, 98%, 4–(N–Boc–amino)phenylboronic acid, 4-(Boc-amino)benzeneboronic acid, 97% , 4-[(tert-Butoxycarbonyl)amino]phenylboronic Acid (contains varying amounts of Anhydride), 4-(N-BOC-amino)phenylboronic acid, 97%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Thermo Scientific (Acros). Available pack sizes: 5g, 25g, 100g, 500g, 1g, 250mg, 10g, 1000g.
[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid (CAS 380430-49-9) is a chemical compound with the molecular formula C11H16BNO4 and a molecular weight of 237.06 g/mol. IUPAC name: [4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid. InChIKey: UBVOLHQIEQVXGM-UHFFFAOYSA-N.
| Molecular formula | C11H16BNO4 |
|---|---|
| Molecular weight | 237.06 g/mol |
| IUPAC name | [4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid |
| InChIKey | UBVOLHQIEQVXGM-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)NC(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)