(4-Boc-aminophenyl)boronic acid 98%
cas: 380430-49-9 — see every product listed under this CAS number, including other names
(4-Boc-aminophenyl)boronic acid 98% (CAS 380430-49-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A298015-250mg |
| cas | 380430-49-9 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 5g | 203.50 Pln | |
| Ambeed | 10g | 220.19 Pln | |
| Ambeed | 25g | 325.88 Pln | |
| Ambeed | 100g | 1093.50 Pln | |
| Ambeed | 500g | 4731.38 Pln | |
| Ambeed | 1000g | 8458.25 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A298015 |
[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid (CAS 380430-49-9) is a chemical compound with the molecular formula C11H16BNO4 and a molecular weight of 237.06 g/mol. IUPAC name: [4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid. InChIKey: UBVOLHQIEQVXGM-UHFFFAOYSA-N.
| Molecular formula | C11H16BNO4 |
|---|---|
| Molecular weight | 237.06 g/mol |
| IUPAC name | [4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid |
| InChIKey | UBVOLHQIEQVXGM-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)NC(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(4-Boc-Aminophenyl)Boronic Acid, 4-(N-Boc-amino)phenylboronic acid, 4-BOC-aminophenylboronic acid, (4-((tert-Butoxycarbonyl)amino)phenyl)boronic acid, [4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic Acid, 4-(Boc-amino)phenylboronic Acid, 4-(tert-Butoxycarbonyl)aminophenylboronic acid, (4-{[(tert-butoxy)carbonyl]amino}phenyl)boronic acid, (4-Boc-Aminophenyl);boronic acid, 4-[(tert-butoxycarbonyl)amino]phenylboronic acid